| H2O solubility in pantelleritic melts: pressure and alkali effects |
3 |
| Sulfur isotope geochemistry of the Chodarchay Cu-Au deposit, Tarom, NW Iran |
3 |
| REE geochemical characteristics and fluid inclusion studies of the Bagher-Abad fluorite deposit, Central Iran |
3 |
| Petrogenesis of an alkaline lamprophyre (camptonite) with ocean island basalt (OIB)-affinity at the NW margin of the Cuddapah basin, eastern Dharwar craton, southern India |
2 |
| Ilmenite generations in kimberlite from Banankoro, Guinea Conakry |
1 |
| Geology and geochemistry of the sediment-hosted stratabound red bed-type Cu-Pb (Zn-Ag) mineralization in the Dozkand-Moshampa Area, NW Zanjan, Iran |
1 |
| Sulfides in alkaline and peralkaline rocks: textural appearance and compositional variations |
1 |
| Mineralogy and geochemistry of the Dehshir listvenites, central Iran |
1 |
| The Chargar Au-Cu deposit: an example of low-sulfidation epithermal mineralization from the Tarom subzone, NW Iran |
1 |
| Biotite compositional variations - A physicochemical approach to investigate crustal involvement and ore potential in Middle Jurassic plutonic rocks from the Malayer-Boroujerd Plutonic complex, W Iran |
0 |
| S and Pb Isotope Geochemistry of the carbonate-hosted Au-Ag-Zn +/- Pb deposits in the Maden Village (Ulukisla-Nigde), Central Taurides, South Turkey |
0 |
| Composition of minerals from the skarn deposits Vaster Silvberg (Sweden) and Tumurtijn-ovoo (Mongolia): Indications of different element supply in submarine hydrothermal-sedimentary ore genesis |
0 |
| Late-Mesozoic tectonic evolution and magmatic history of the Zhe-Gan-Wan region, SE China: evidence from the Shiling rhyolite and other Yanshanian granitoids |
0 |
| Green mawbyite, PbFe3+F0.42+Zn0.6(AsO4)(2)OH(H2O), from the Lagoa mine, northern Portugal |
0 |
| The carbonate and silicate mineralogy of the Zhilingtou gold-silver deposit, Zhejiang Province, south-eastern China |
0 |
| Surface dissolution features and contact twinning in natural diamonds |
0 |
| The crystal structure of hanksite, Na22K(CO3)(2)(SO4)(9)CI, refined from high-resolution X-ray diffraction data |
0 |
| Crystal structures of monoclinic variants of two SFCA structure-types containing significant Fe2+: crystal structure of monoclinic SFCA-II, Ca2.6Fe8.03+Fe3.42+Al4O24; and proposed crystal structure of monoclinic SFCA-I, ideally, Ca2Fe82+Fe83+Al4O28 |
0 |
| Geochemistry, texture, and mineralogy of the supergene iron oxide deposits from the Binaloud zone, NE Iran |
0 |
| Anomalies in the depth of the asthenospheric mantle: key to the enigma of adakites in the Urumieh-Dokhtar magmatic arc |
0 |
| Post-mining amorphous Cu-Al hydroxyphosphate from West Caradon Mine, Liskeard, UK |
0 |
| Uranium-rich pyrochlores flrom the Iimaussaq complex, South Greenland |
0 |
| Feodosiyite, Cu11Mg2Cl18(OH)(8) center dot 16H(2)O, a new mineral from the Tolbachik volcano, Kamchatka, Russia |
0 |
| From subcalcic pyropes to uvarovites: experimental crystallization of Cr-rich garnets in ultramafic systems with presence of Ca-bearing hydrous fluid |
0 |
| Asbestiform Antigorite: A dangerous mineral in Serpentinites. A plea to treat asbestiform antigorite as an asbestos group mineral in terms of its occupational health safety effects |
0 |
| Vondechenite, a new hydrous calcium copper chloride hydroxide, from the Bellerberg, East-Eifel volcanic area, Germany |
0 |
| Geological, mineralogical and fluid inclusion characteristics of auriferous quartz veins at Guneykoy (Usak, Esme), Western Turkey |
0 |
